C10H10ClN3O2 — CID 82343002
ethyl 3-amino-5-chloroimidazo[1,2-a]pyridine-2-carboxylate (PubChem CID 82343002) has the molecular formula C10H10ClN3O2 and a molecular weight of 239.66 g/mol. Its IUPAC name is ethyl 3-amino-5-chloroimidazo[1,2-a]pyridine-2-carboxylate.
| Compound Name | ethyl 3-amino-5-chloroimidazo[1,2-a]pyridine-2-carboxylate |
|---|---|
| PubChem CID | 82343002 |
| Molecular Formula | C10H10ClN3O2 |
| Molecular Weight | 239.66 g/mol |
| Exact Mass | 239.05 |
| IUPAC Name | ethyl 3-amino-5-chloroimidazo[1,2-a]pyridine-2-carboxylate |
| SMILES | CCOC(=O)c1nc2cccc(Cl)n2c1N |
| InChI | InChI=1S/C10H10ClN3O2/c1-2-16-10(15)8-9(12)14-6(11)4-3-5-7(14)13-8/h3-5H,2,12H2,1H3 |
| InChIKey | LTGKDYRDFIYDAF-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.66 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|