C11H11BrN2O2 — CID 130113655
ethyl 5-bromo-2-methylimidazo[1,2-a]pyridine-3-carboxylate (PubChem CID 130113655) has the molecular formula C11H11BrN2O2 and a molecular weight of 283.13 g/mol. Its IUPAC name is ethyl 5-bromo-2-methylimidazo[1,2-a]pyridine-3-carboxylate.
| Compound Name | ethyl 5-bromo-2-methylimidazo[1,2-a]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 130113655 |
| Molecular Formula | C11H11BrN2O2 |
| Molecular Weight | 283.13 g/mol |
| Exact Mass | 282.00 |
| IUPAC Name | ethyl 5-bromo-2-methylimidazo[1,2-a]pyridine-3-carboxylate |
| SMILES | CCOC(=O)c1c(C)nc2cccc(Br)n12 |
| InChI | InChI=1S/C11H11BrN2O2/c1-3-16-11(15)10-7(2)13-9-6-4-5-8(12)14(9)10/h4-6H,3H2,1-2H3 |
| InChIKey | XZBPEPPYKLHQPP-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.13 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|