C15H14ClN3 — CID 82342842
[5-chloro-2-(4-methylphenyl)imidazo[1,2-a]pyridin-3-yl]methanamine (PubChem CID 82342842) has the molecular formula C15H14ClN3 and a molecular weight of 271.75 g/mol. Its IUPAC name is [5-chloro-2-(4-methylphenyl)imidazo[1,2-a]pyridin-3-yl]methanamine.
| Compound Name | [5-chloro-2-(4-methylphenyl)imidazo[1,2-a]pyridin-3-yl]methanamine |
|---|---|
| PubChem CID | 82342842 |
| Molecular Formula | C15H14ClN3 |
| Molecular Weight | 271.75 g/mol |
| Exact Mass | 271.09 |
| IUPAC Name | [5-chloro-2-(4-methylphenyl)imidazo[1,2-a]pyridin-3-yl]methanamine |
| SMILES | Cc1ccc(-c2nc3cccc(Cl)n3c2CN)cc1 |
| InChI | InChI=1S/C15H14ClN3/c1-10-5-7-11(8-6-10)15-12(9-17)19-13(16)3-2-4-14(19)18-15/h2-8H,9,17H2,1H3 |
| InChIKey | SXQJRQVHKBMCQW-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 43.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.75 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|