C18H20N3OP — CID 123693279
ethane;3-(4-methylphenyl)-6-phosphanyl-2,6,12-triazatricyclo[6.3.1.04,12]dodeca-1,3,8,10-tetraen-7-one (PubChem CID 123693279) has the molecular formula C18H20N3OP and a molecular weight of 325.35 g/mol. Its IUPAC name is ethane;3-(4-methylphenyl)-6-phosphanyl-2,6,12-triazatricyclo[6.3.1.04,12]dodeca-1,3,8,10-tetraen-7-one.
| Compound Name | ethane;3-(4-methylphenyl)-6-phosphanyl-2,6,12-triazatricyclo[6.3.1.04,12]dodeca-1,3,8,10-tetraen-7-one |
|---|---|
| PubChem CID | 123693279 |
| Molecular Formula | C18H20N3OP |
| Molecular Weight | 325.35 g/mol |
| Exact Mass | 325.13 |
| IUPAC Name | ethane;3-(4-methylphenyl)-6-phosphanyl-2,6,12-triazatricyclo[6.3.1.04,12]dodeca-1,3,8,10-tetraen-7-one |
| SMILES | CC.Cc1ccc(-c2nc3cccc4n3c2CN(P)C4=O)cc1 |
| InChI | InChI=1S/C16H14N3OP.C2H6/c1-10-5-7-11(8-6-10)15-13-9-18(21)16(20)12-3-2-4-14(17-15)19(12)13;1-2/h2-8H,9,21H2,1H3;1-2H3 |
| InChIKey | VRJNIZSCULZAPV-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 37.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.35 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|