C10H12ClN3S — CID 141154147
5-chloro-2-(2-methylsulfanylethyl)imidazo[1,2-a]pyridin-3-amine (PubChem CID 141154147) has the molecular formula C10H12ClN3S and a molecular weight of 241.75 g/mol. Its IUPAC name is 5-chloro-2-(2-methylsulfanylethyl)imidazo[1,2-a]pyridin-3-amine.
| Compound Name | 5-chloro-2-(2-methylsulfanylethyl)imidazo[1,2-a]pyridin-3-amine |
|---|---|
| PubChem CID | 141154147 |
| Molecular Formula | C10H12ClN3S |
| Molecular Weight | 241.75 g/mol |
| Exact Mass | 241.04 |
| IUPAC Name | 5-chloro-2-(2-methylsulfanylethyl)imidazo[1,2-a]pyridin-3-amine |
| SMILES | CSCCc1nc2cccc(Cl)n2c1N |
| InChI | InChI=1S/C10H12ClN3S/c1-15-6-5-7-10(12)14-8(11)3-2-4-9(14)13-7/h2-4H,5-6,12H2,1H3 |
| InChIKey | BWEIIPIOISVXMK-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 43.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.75 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|