C7H3Cl2NOS — CID 117258864
5-chloro-2-(5-chlorothiophen-2-yl)-1,3-oxazole (PubChem CID 117258864) has the molecular formula C7H3Cl2NOS and a molecular weight of 220.08 g/mol. Its IUPAC name is 5-chloro-2-(5-chlorothiophen-2-yl)-1,3-oxazole.
| Compound Name | 5-chloro-2-(5-chlorothiophen-2-yl)-1,3-oxazole |
|---|---|
| PubChem CID | 117258864 |
| Molecular Formula | C7H3Cl2NOS |
| Molecular Weight | 220.08 g/mol |
| Exact Mass | 218.93 |
| IUPAC Name | 5-chloro-2-(5-chlorothiophen-2-yl)-1,3-oxazole |
| SMILES | Clc1cnc(-c2ccc(Cl)s2)o1 |
| InChI | InChI=1S/C7H3Cl2NOS/c8-5-3-10-7(11-5)4-1-2-6(9)12-4/h1-3H |
| InChIKey | FECIFWFLDCHOPH-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.08 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |