C8H7ClN4S — CID 166793488
3-(5-chlorothiophen-2-yl)pyrazine-2,5-diamine (PubChem CID 166793488) has the molecular formula C8H7ClN4S and a molecular weight of 226.69 g/mol. Its IUPAC name is 3-(5-chlorothiophen-2-yl)pyrazine-2,5-diamine.
| Compound Name | 3-(5-chlorothiophen-2-yl)pyrazine-2,5-diamine |
|---|---|
| PubChem CID | 166793488 |
| Molecular Formula | C8H7ClN4S |
| Molecular Weight | 226.69 g/mol |
| Exact Mass | 226.01 |
| IUPAC Name | 3-(5-chlorothiophen-2-yl)pyrazine-2,5-diamine |
| SMILES | Nc1cnc(N)c(-c2ccc(Cl)s2)n1 |
| InChI | InChI=1S/C8H7ClN4S/c9-5-2-1-4(14-5)7-8(11)12-3-6(10)13-7/h1-3H,(H2,10,13)(H2,11,12) |
| InChIKey | ZASBTISFCSJZSF-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 77.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.69 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |