C17H11Cl2N5S — CID 154608536
8-(2-chloro-6-methyl-4-pyridinyl)-7-(5-chlorothiophen-2-yl)pyrido[3,4-b]pyrazin-5-amine (PubChem CID 154608536) has the molecular formula C17H11Cl2N5S and a molecular weight of 388.28 g/mol. Its IUPAC name is 8-(2-chloro-6-methyl-4-pyridinyl)-7-(5-chlorothiophen-2-yl)pyrido[3,4-b]pyrazin-5-amine.
| Compound Name | 8-(2-chloro-6-methyl-4-pyridinyl)-7-(5-chlorothiophen-2-yl)pyrido[3,4-b]pyrazin-5-amine |
|---|---|
| PubChem CID | 154608536 |
| Molecular Formula | C17H11Cl2N5S |
| Molecular Weight | 388.28 g/mol |
| Exact Mass | 387.01 |
| IUPAC Name | 8-(2-chloro-6-methyl-4-pyridinyl)-7-(5-chlorothiophen-2-yl)pyrido[3,4-b]pyrazin-5-amine |
| SMILES | Cc1cc(-c2c(-c3ccc(Cl)s3)nc(N)c3nccnc23)cc(Cl)n1 |
| InChI | InChI=1S/C17H11Cl2N5S/c1-8-6-9(7-11(18)23-8)13-14(10-2-3-12(19)25-10)24-17(20)16-15(13)21-4-5-22-16/h2-7H,1H3,(H2,20,24) |
| InChIKey | WHFGRWFBZYHAMF-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 77.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.28 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|