C15H19N3O3 — CID 117262554
6-methoxy-1-methyl-3-(pyrrolidin-3-ylmethyl)quinazoline-2,4-dione (PubChem CID 117262554) has the molecular formula C15H19N3O3 and a molecular weight of 289.33 g/mol. Its IUPAC name is 6-methoxy-1-methyl-3-(pyrrolidin-3-ylmethyl)quinazoline-2,4-dione.
| Compound Name | 6-methoxy-1-methyl-3-(pyrrolidin-3-ylmethyl)quinazoline-2,4-dione |
|---|---|
| PubChem CID | 117262554 |
| Molecular Formula | C15H19N3O3 |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.14 |
| IUPAC Name | 6-methoxy-1-methyl-3-(pyrrolidin-3-ylmethyl)quinazoline-2,4-dione |
| SMILES | COc1ccc2c(c1)c(=O)n(CC1CCNC1)c(=O)n2C |
| InChI | InChI=1S/C15H19N3O3/c1-17-13-4-3-11(21-2)7-12(13)14(19)18(15(17)20)9-10-5-6-16-8-10/h3-4,7,10,16H,5-6,8-9H2,1-2H3 |
| InChIKey | DOYONJBQKTYDOL-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 65.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |