About 2-(7-hydroxy-2,4-dioxo-1H-quinazolin-3-yl)acetaldehyde
2-(7-hydroxy-2,4-dioxo-1H-quinazolin-3-yl)acetaldehyde (PubChem CID 117262789) has the molecular formula C10H8N2O4
and a molecular weight of 220.18 g/mol. Its IUPAC name is 2-(7-hydroxy-2,4-dioxo-1H-quinazolin-3-yl)acetaldehyde.
Molecular Properties
| Compound Name | 2-(7-hydroxy-2,4-dioxo-1H-quinazolin-3-yl)acetaldehyde |
| PubChem CID | 117262789 |
| Molecular Formula | C10H8N2O4 |
| Molecular Weight | 220.18 g/mol |
| Exact Mass | 220.05 |
| IUPAC Name | 2-(7-hydroxy-2,4-dioxo-1H-quinazolin-3-yl)acetaldehyde |
| SMILES | O=CCn1c(=O)[nH]c2cc(O)ccc2c1=O |
| InChI | InChI=1S/C10H8N2O4/c13-4-3-12-9(15)7-2-1-6(14)5-8(7)11-10(12)16/h1-2,4-5,14H,3H2,(H,11,16) |
| InChIKey | YUNGMENBIOXDDE-UHFFFAOYSA-N |
| XLogP | -0.41 |
| TPSA | 92.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.18 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-(7-hydroxy-2,4-dioxo-1H-quinazolin-3-yl)acetaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(7-hydroxy-2,4-dioxo-1H-quinazolin-3-yl)acetaldehyde?
The IUPAC name of 2-(7-hydroxy-2,4-dioxo-1H-quinazolin-3-yl)acetaldehyde (CID 117262789) is 2-(7-hydroxy-2,4-dioxo-1H-quinazolin-3-yl)acetaldehyde.
What is the SMILES notation for 2-(7-hydroxy-2,4-dioxo-1H-quinazolin-3-yl)acetaldehyde?
The canonical SMILES for 2-(7-hydroxy-2,4-dioxo-1H-quinazolin-3-yl)acetaldehyde is O=CCn1c(=O)[nH]c2cc(O)ccc2c1=O.
What is the InChIKey of 2-(7-hydroxy-2,4-dioxo-1H-quinazolin-3-yl)acetaldehyde?
The InChIKey is YUNGMENBIOXDDE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8N2O4/c13-4-3-12-9(15)7-2-1-6(14)5-8(7)11-10(12)16/h1-2,4-5,14H,3H2,(H,11,16).
What are the key properties of 2-(7-hydroxy-2,4-dioxo-1H-quinazolin-3-yl)acetaldehyde?
2-(7-hydroxy-2,4-dioxo-1H-quinazolin-3-yl)acetaldehyde has a molecular weight of 220.18 g/mol, XLogP of -0.41, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(7-hydroxy-2,4-dioxo-1H-quinazolin-3-yl)acetaldehyde is sourced from PubChem (CID 117262789), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).