C13H16N2O3 — CID 117261338
3-(2,2-dimethylpropyl)-6-hydroxy-1H-quinazoline-2,4-dione (PubChem CID 117261338) has the molecular formula C13H16N2O3 and a molecular weight of 248.28 g/mol. Its IUPAC name is 3-(2,2-dimethylpropyl)-6-hydroxy-1H-quinazoline-2,4-dione.
| Compound Name | 3-(2,2-dimethylpropyl)-6-hydroxy-1H-quinazoline-2,4-dione |
|---|---|
| PubChem CID | 117261338 |
| Molecular Formula | C13H16N2O3 |
| Molecular Weight | 248.28 g/mol |
| Exact Mass | 248.12 |
| IUPAC Name | 3-(2,2-dimethylpropyl)-6-hydroxy-1H-quinazoline-2,4-dione |
| SMILES | CC(C)(C)Cn1c(=O)[nH]c2ccc(O)cc2c1=O |
| InChI | InChI=1S/C13H16N2O3/c1-13(2,3)7-15-11(17)9-6-8(16)4-5-10(9)14-12(15)18/h4-6,16H,7H2,1-3H3,(H,14,18) |
| InChIKey | PORUYHSOPNWROT-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 75.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.28 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |