C9H17NO — CID 117266009
(Z)-3-(1-ethylpyrrolidin-2-yl)prop-2-en-1-ol (PubChem CID 117266009) has the molecular formula C9H17NO and a molecular weight of 155.24 g/mol. Its IUPAC name is (Z)-3-(1-ethylpyrrolidin-2-yl)prop-2-en-1-ol.
| Compound Name | (Z)-3-(1-ethylpyrrolidin-2-yl)prop-2-en-1-ol |
|---|---|
| PubChem CID | 117266009 |
| Molecular Formula | C9H17NO |
| Molecular Weight | 155.24 g/mol |
| Exact Mass | 155.13 |
| IUPAC Name | (Z)-3-(1-ethylpyrrolidin-2-yl)prop-2-en-1-ol |
| SMILES | CCN1CCCC1/C=C\CO |
| InChI | InChI=1S/C9H17NO/c1-2-10-7-3-5-9(10)6-4-8-11/h4,6,9,11H,2-3,5,7-8H2,1H3/b6-4- |
| InChIKey | WZMIKGMPUHPTRJ-XQRVVYSFSA-N |
| XLogP | 1.02 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.24 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|