C10H19NO — CID 117266010
(Z)-3-(1-propan-2-ylpyrrolidin-2-yl)prop-2-en-1-ol (PubChem CID 117266010) has the molecular formula C10H19NO and a molecular weight of 169.27 g/mol. Its IUPAC name is (Z)-3-(1-propan-2-ylpyrrolidin-2-yl)prop-2-en-1-ol.
| Compound Name | (Z)-3-(1-propan-2-ylpyrrolidin-2-yl)prop-2-en-1-ol |
|---|---|
| PubChem CID | 117266010 |
| Molecular Formula | C10H19NO |
| Molecular Weight | 169.27 g/mol |
| Exact Mass | 169.15 |
| IUPAC Name | (Z)-3-(1-propan-2-ylpyrrolidin-2-yl)prop-2-en-1-ol |
| SMILES | CC(C)N1CCCC1/C=C\CO |
| InChI | InChI=1S/C10H19NO/c1-9(2)11-7-3-5-10(11)6-4-8-12/h4,6,9-10,12H,3,5,7-8H2,1-2H3/b6-4- |
| InChIKey | PSPAYUOWIKJCCY-XQRVVYSFSA-N |
| XLogP | 1.41 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.27 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|