C10H18O3S — CID 117267470
(Z)-5-(1,1-dioxothian-4-yl)pent-3-en-1-ol (PubChem CID 117267470) has the molecular formula C10H18O3S and a molecular weight of 218.32 g/mol. Its IUPAC name is (Z)-5-(1,1-dioxothian-4-yl)pent-3-en-1-ol.
| Compound Name | (Z)-5-(1,1-dioxothian-4-yl)pent-3-en-1-ol |
|---|---|
| PubChem CID | 117267470 |
| Molecular Formula | C10H18O3S |
| Molecular Weight | 218.32 g/mol |
| Exact Mass | 218.10 |
| IUPAC Name | (Z)-5-(1,1-dioxothian-4-yl)pent-3-en-1-ol |
| SMILES | O=S1(=O)CCC(C/C=C\CCO)CC1 |
| InChI | InChI=1S/C10H18O3S/c11-7-3-1-2-4-10-5-8-14(12,13)9-6-10/h1-2,10-11H,3-9H2/b2-1- |
| InChIKey | IERBHCRAFRUPGR-UPHRSURJSA-N |
| XLogP | 1.14 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.32 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|