C10H14BrNS — CID 117269751
4-(5-bromothiophen-2-yl)-2,2-dimethylpyrrolidine (PubChem CID 117269751) has the molecular formula C10H14BrNS and a molecular weight of 260.20 g/mol. Its IUPAC name is 4-(5-bromothiophen-2-yl)-2,2-dimethylpyrrolidine.
| Compound Name | 4-(5-bromothiophen-2-yl)-2,2-dimethylpyrrolidine |
|---|---|
| PubChem CID | 117269751 |
| Molecular Formula | C10H14BrNS |
| Molecular Weight | 260.20 g/mol |
| Exact Mass | 259.00 |
| IUPAC Name | 4-(5-bromothiophen-2-yl)-2,2-dimethylpyrrolidine |
| SMILES | CC1(C)CC(c2ccc(Br)s2)CN1 |
| InChI | InChI=1S/C10H14BrNS/c1-10(2)5-7(6-12-10)8-3-4-9(11)13-8/h3-4,7,12H,5-6H2,1-2H3 |
| InChIKey | QQLORWIVEJONMF-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.20 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |