C10H14BrNOS — CID 117226749
2-(5-bromothiophen-2-yl)-5,5-dimethyl-1,3-oxazinane (PubChem CID 117226749) has the molecular formula C10H14BrNOS and a molecular weight of 276.20 g/mol. Its IUPAC name is 2-(5-bromothiophen-2-yl)-5,5-dimethyl-1,3-oxazinane.
| Compound Name | 2-(5-bromothiophen-2-yl)-5,5-dimethyl-1,3-oxazinane |
|---|---|
| PubChem CID | 117226749 |
| Molecular Formula | C10H14BrNOS |
| Molecular Weight | 276.20 g/mol |
| Exact Mass | 275.00 |
| IUPAC Name | 2-(5-bromothiophen-2-yl)-5,5-dimethyl-1,3-oxazinane |
| SMILES | CC1(C)CNC(c2ccc(Br)s2)OC1 |
| InChI | InChI=1S/C10H14BrNOS/c1-10(2)5-12-9(13-6-10)7-3-4-8(11)14-7/h3-4,9,12H,5-6H2,1-2H3 |
| InChIKey | GGXGBCMVGTVYSD-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.20 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |