C9H12ClNOS — CID 117228170
2-(5-chlorothiophen-2-yl)-4,4-dimethyl-1,3-oxazolidine (PubChem CID 117228170) has the molecular formula C9H12ClNOS and a molecular weight of 217.72 g/mol. Its IUPAC name is 2-(5-chlorothiophen-2-yl)-4,4-dimethyl-1,3-oxazolidine.
| Compound Name | 2-(5-chlorothiophen-2-yl)-4,4-dimethyl-1,3-oxazolidine |
|---|---|
| PubChem CID | 117228170 |
| Molecular Formula | C9H12ClNOS |
| Molecular Weight | 217.72 g/mol |
| Exact Mass | 217.03 |
| IUPAC Name | 2-(5-chlorothiophen-2-yl)-4,4-dimethyl-1,3-oxazolidine |
| SMILES | CC1(C)COC(c2ccc(Cl)s2)N1 |
| InChI | InChI=1S/C9H12ClNOS/c1-9(2)5-12-8(11-9)6-3-4-7(10)13-6/h3-4,8,11H,5H2,1-2H3 |
| InChIKey | ZCOPAZRJVDTTCD-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.72 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |