About 3-(4,4-dimethyl-1,3-oxazolidin-2-yl)phenol;hydrochloride
3-(4,4-dimethyl-1,3-oxazolidin-2-yl)phenol;hydrochloride (PubChem CID 117228463) has the molecular formula C11H16ClNO2
and a molecular weight of 229.71 g/mol. Its IUPAC name is 3-(4,4-dimethyl-1,3-oxazolidin-2-yl)phenol;hydrochloride.
Molecular Properties
| Compound Name | 3-(4,4-dimethyl-1,3-oxazolidin-2-yl)phenol;hydrochloride |
| PubChem CID | 117228463 |
| Molecular Formula | C11H16ClNO2 |
| Molecular Weight | 229.71 g/mol |
| Exact Mass | 229.09 |
| IUPAC Name | 3-(4,4-dimethyl-1,3-oxazolidin-2-yl)phenol;hydrochloride |
| SMILES | CC1(C)COC(c2cccc(O)c2)N1.Cl |
| InChI | InChI=1S/C11H15NO2.ClH/c1-11(2)7-14-10(12-11)8-4-3-5-9(13)6-8;/h3-6,10,12-13H,7H2,1-2H3;1H |
| InChIKey | VVHCGUFSWALCPF-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.71 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(4,4-dimethyl-1,3-oxazolidin-2-yl)phenol;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4,4-dimethyl-1,3-oxazolidin-2-yl)phenol;hydrochloride?
The IUPAC name of 3-(4,4-dimethyl-1,3-oxazolidin-2-yl)phenol;hydrochloride (CID 117228463) is 3-(4,4-dimethyl-1,3-oxazolidin-2-yl)phenol;hydrochloride.
What is the SMILES notation for 3-(4,4-dimethyl-1,3-oxazolidin-2-yl)phenol;hydrochloride?
The canonical SMILES for 3-(4,4-dimethyl-1,3-oxazolidin-2-yl)phenol;hydrochloride is CC1(C)COC(c2cccc(O)c2)N1.Cl.
What is the InChIKey of 3-(4,4-dimethyl-1,3-oxazolidin-2-yl)phenol;hydrochloride?
The InChIKey is VVHCGUFSWALCPF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15NO2.ClH/c1-11(2)7-14-10(12-11)8-4-3-5-9(13)6-8;/h3-6,10,12-13H,7H2,1-2H3;1H.
What are the key properties of 3-(4,4-dimethyl-1,3-oxazolidin-2-yl)phenol;hydrochloride?
3-(4,4-dimethyl-1,3-oxazolidin-2-yl)phenol;hydrochloride has a molecular weight of 229.71 g/mol, XLogP of 2.21, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4,4-dimethyl-1,3-oxazolidin-2-yl)phenol;hydrochloride is sourced from PubChem (CID 117228463), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).