C10H14ClNOS — CID 117228975
2-(5-chlorothiophen-2-yl)-2,5,5-trimethyl-1,3-oxazolidine (PubChem CID 117228975) has the molecular formula C10H14ClNOS and a molecular weight of 231.75 g/mol. Its IUPAC name is 2-(5-chlorothiophen-2-yl)-2,5,5-trimethyl-1,3-oxazolidine.
| Compound Name | 2-(5-chlorothiophen-2-yl)-2,5,5-trimethyl-1,3-oxazolidine |
|---|---|
| PubChem CID | 117228975 |
| Molecular Formula | C10H14ClNOS |
| Molecular Weight | 231.75 g/mol |
| Exact Mass | 231.05 |
| IUPAC Name | 2-(5-chlorothiophen-2-yl)-2,5,5-trimethyl-1,3-oxazolidine |
| SMILES | CC1(C)CNC(C)(c2ccc(Cl)s2)O1 |
| InChI | InChI=1S/C10H14ClNOS/c1-9(2)6-12-10(3,13-9)7-4-5-8(11)14-7/h4-5,12H,6H2,1-3H3 |
| InChIKey | DAUVVUYEFZFFJD-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.75 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |