C17H27NO5 — CID 11727108
(2R,3S,4S)-3,4-bis(methoxymethoxy)-2-[(4-methoxyphenyl)methyl]-1-methylpyrrolidine (PubChem CID 11727108) has the molecular formula C17H27NO5 and a molecular weight of 325.41 g/mol. Its IUPAC name is (2R,3S,4S)-3,4-bis(methoxymethoxy)-2-[(4-methoxyphenyl)methyl]-1-methylpyrrolidine.
| Compound Name | (2R,3S,4S)-3,4-bis(methoxymethoxy)-2-[(4-methoxyphenyl)methyl]-1-methylpyrrolidine |
|---|---|
| PubChem CID | 11727108 |
| Molecular Formula | C17H27NO5 |
| Molecular Weight | 325.41 g/mol |
| Exact Mass | 325.19 |
| IUPAC Name | (2R,3S,4S)-3,4-bis(methoxymethoxy)-2-[(4-methoxyphenyl)methyl]-1-methylpyrrolidine |
| SMILES | COCO[C@@H]1[C@@H](OCOC)CN(C)[C@@H]1Cc1ccc(OC)cc1 |
| InChI | InChI=1S/C17H27NO5/c1-18-10-16(22-11-19-2)17(23-12-20-3)15(18)9-13-5-7-14(21-4)8-6-13/h5-8,15-17H,9-12H2,1-4H3/t15-,16+,17+/m1/s1 |
| InChIKey | LQGBPLOKLNGBOY-IKGGRYGDSA-N |
| XLogP | 1.53 |
| TPSA | 49.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.41 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|