C23H27NO — CID 11727342
(1S,5R)-3-(2-benzhydryloxyethylidene)-8-methyl-8-azabicyclo[3.2.1]octane (PubChem CID 11727342) has the molecular formula C23H27NO and a molecular weight of 333.48 g/mol. Its IUPAC name is (1S,5R)-3-(2-benzhydryloxyethylidene)-8-methyl-8-azabicyclo[3.2.1]octane.
| Compound Name | (1S,5R)-3-(2-benzhydryloxyethylidene)-8-methyl-8-azabicyclo[3.2.1]octane |
|---|---|
| PubChem CID | 11727342 |
| Molecular Formula | C23H27NO |
| Molecular Weight | 333.48 g/mol |
| Exact Mass | 333.21 |
| IUPAC Name | (1S,5R)-3-(2-benzhydryloxyethylidene)-8-methyl-8-azabicyclo[3.2.1]octane |
| SMILES | CN1[C@@H]2CC[C@H]1C/C(=C\COC(c1ccccc1)c1ccccc1)C2 |
| InChI | InChI=1S/C23H27NO/c1-24-21-12-13-22(24)17-18(16-21)14-15-25-23(19-8-4-2-5-9-19)20-10-6-3-7-11-20/h2-11,14,21-23H,12-13,15-17H2,1H3/b18-14-/t21-,22+/m1/s1 |
| InChIKey | FDHDGKBELYFWPD-DSKUNAGASA-N |
| XLogP | 4.98 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.48 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|