C9H13NO4 — CID 117273497
6-oxo-3,4,7,8,9,9a-hexahydro-1H-pyrido[2,1-c][1,4]oxazine-7-carboxylic acid (PubChem CID 117273497) has the molecular formula C9H13NO4 and a molecular weight of 199.21 g/mol. Its IUPAC name is 6-oxo-3,4,7,8,9,9a-hexahydro-1H-pyrido[2,1-c][1,4]oxazine-7-carboxylic acid.
| Compound Name | 6-oxo-3,4,7,8,9,9a-hexahydro-1H-pyrido[2,1-c][1,4]oxazine-7-carboxylic acid |
|---|---|
| PubChem CID | 117273497 |
| Molecular Formula | C9H13NO4 |
| Molecular Weight | 199.21 g/mol |
| Exact Mass | 199.08 |
| IUPAC Name | 6-oxo-3,4,7,8,9,9a-hexahydro-1H-pyrido[2,1-c][1,4]oxazine-7-carboxylic acid |
| SMILES | O=C(O)C1CCC2COCCN2C1=O |
| InChI | InChI=1S/C9H13NO4/c11-8-7(9(12)13)2-1-6-5-14-4-3-10(6)8/h6-7H,1-5H2,(H,12,13) |
| InChIKey | GGOHEJPNRUSZEQ-UHFFFAOYSA-N |
| XLogP | -0.29 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.21 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|