C9H7F2N — CID 117276458
2-(2,2-difluoroethyl)benzonitrile (PubChem CID 117276458) has the molecular formula C9H7F2N and a molecular weight of 167.16 g/mol. Its IUPAC name is 2-(2,2-difluoroethyl)benzonitrile.
| Compound Name | 2-(2,2-difluoroethyl)benzonitrile |
|---|---|
| PubChem CID | 117276458 |
| Molecular Formula | C9H7F2N |
| Molecular Weight | 167.16 g/mol |
| Exact Mass | 167.05 |
| IUPAC Name | 2-(2,2-difluoroethyl)benzonitrile |
| SMILES | N#Cc1ccccc1CC(F)F |
| InChI | InChI=1S/C9H7F2N/c10-9(11)5-7-3-1-2-4-8(7)6-12/h1-4,9H,5H2 |
| InChIKey | IMJKHPSVGSCGNP-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.16 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |