C21H22N2O3 — CID 11727822
methyl (1S,9R,12S)-11-benzyl-12-methyl-10-oxo-11,13-diazatricyclo[7.3.1.02,7]trideca-2,4,6-triene-13-carboxylate (PubChem CID 11727822) has the molecular formula C21H22N2O3 and a molecular weight of 350.42 g/mol. Its IUPAC name is methyl (1S,9R,12S)-11-benzyl-12-methyl-10-oxo-11,13-diazatricyclo[7.3.1.02,7]trideca-2,4,6-triene-13-carboxylate.
| Compound Name | methyl (1S,9R,12S)-11-benzyl-12-methyl-10-oxo-11,13-diazatricyclo[7.3.1.02,7]trideca-2,4,6-triene-13-carboxylate |
|---|---|
| PubChem CID | 11727822 |
| Molecular Formula | C21H22N2O3 |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.16 |
| IUPAC Name | methyl (1S,9R,12S)-11-benzyl-12-methyl-10-oxo-11,13-diazatricyclo[7.3.1.02,7]trideca-2,4,6-triene-13-carboxylate |
| SMILES | COC(=O)N1[C@@H]2Cc3ccccc3[C@H]1[C@H](C)N(Cc1ccccc1)C2=O |
| InChI | InChI=1S/C21H22N2O3/c1-14-19-17-11-7-6-10-16(17)12-18(23(19)21(25)26-2)20(24)22(14)13-15-8-4-3-5-9-15/h3-11,14,18-19H,12-13H2,1-2H3/t14-,18+,19+/m0/s1 |
| InChIKey | DFIAOXUXQRUVKN-GDIGMMSISA-N |
| XLogP | 3.15 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |