C11H16O2 — CID 117278450
2-ethyl-4-(1-hydroxyethyl)-5-methylphenol (PubChem CID 117278450) has the molecular formula C11H16O2 and a molecular weight of 180.25 g/mol. Its IUPAC name is 2-ethyl-4-(1-hydroxyethyl)-5-methylphenol.
| Compound Name | 2-ethyl-4-(1-hydroxyethyl)-5-methylphenol |
|---|---|
| PubChem CID | 117278450 |
| Molecular Formula | C11H16O2 |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.12 |
| IUPAC Name | 2-ethyl-4-(1-hydroxyethyl)-5-methylphenol |
| SMILES | CCc1cc(C(C)O)c(C)cc1O |
| InChI | InChI=1S/C11H16O2/c1-4-9-6-10(8(3)12)7(2)5-11(9)13/h5-6,8,12-13H,4H2,1-3H3 |
| InChIKey | LCGPFLDBHXVGQM-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |