C5H14N2S2 — CID 11728
dimethylazanium;N,N-dimethylcarbamodithioate (PubChem CID 11728) has the molecular formula C5H14N2S2 and a molecular weight of 166.31 g/mol. Its IUPAC name is dimethylazanium;N,N-dimethylcarbamodithioate.
| Compound Name | dimethylazanium;N,N-dimethylcarbamodithioate |
|---|---|
| PubChem CID | 11728 |
| Molecular Formula | C5H14N2S2 |
| Molecular Weight | 166.31 g/mol |
| Exact Mass | 166.06 |
| IUPAC Name | dimethylazanium;N,N-dimethylcarbamodithioate |
| SMILES | CN(C)C(=S)[S-].C[NH2+]C |
| InChI | InChI=1S/C3H7NS2.C2H7N/c1-4(2)3(5)6;1-3-2/h1-2H3,(H,5,6);3H,1-2H3 |
| InChIKey | UVOFGKIRTCCNKG-UHFFFAOYSA-N |
| XLogP | -0.81 |
| TPSA | 19.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.31 |
| LogP ≤ 5 | -0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|