About N-methylcarbamodithioate;trimethylazanium
N-methylcarbamodithioate;trimethylazanium (PubChem CID 90073919) has the molecular formula C5H14N2S2
and a molecular weight of 166.31 g/mol. Its IUPAC name is N-methylcarbamodithioate;trimethylazanium.
Molecular Properties
| Compound Name | N-methylcarbamodithioate;trimethylazanium |
| PubChem CID | 90073919 |
| Molecular Formula | C5H14N2S2 |
| Molecular Weight | 166.31 g/mol |
| Exact Mass | 166.06 |
| IUPAC Name | N-methylcarbamodithioate;trimethylazanium |
| SMILES | CNC(=S)[S-].C[NH+](C)C |
| InChI | InChI=1S/C3H9N.C2H5NS2/c1-4(2)3;1-3-2(4)5/h1-3H3;1H3,(H2,3,4,5) |
| InChIKey | CULCAOUZPPNSRA-UHFFFAOYSA-N |
| XLogP | -1.20 |
| TPSA | 16.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.31 |
| LogP ≤ 5 | -1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|
Analyze N-methylcarbamodithioate;trimethylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methylcarbamodithioate;trimethylazanium?
The IUPAC name of N-methylcarbamodithioate;trimethylazanium (CID 90073919) is N-methylcarbamodithioate;trimethylazanium.
What is the SMILES notation for N-methylcarbamodithioate;trimethylazanium?
The canonical SMILES for N-methylcarbamodithioate;trimethylazanium is CNC(=S)[S-].C[NH+](C)C.
What is the InChIKey of N-methylcarbamodithioate;trimethylazanium?
The InChIKey is CULCAOUZPPNSRA-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H9N.C2H5NS2/c1-4(2)3;1-3-2(4)5/h1-3H3;1H3,(H2,3,4,5).
What are the key properties of N-methylcarbamodithioate;trimethylazanium?
N-methylcarbamodithioate;trimethylazanium has a molecular weight of 166.31 g/mol, XLogP of -1.20, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-methylcarbamodithioate;trimethylazanium is sourced from PubChem (CID 90073919), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).