C11H15NS — CID 117284206
1-(2,3-dihydro-1-benzothiophen-6-yl)propan-2-amine (PubChem CID 117284206) has the molecular formula C11H15NS and a molecular weight of 193.31 g/mol. Its IUPAC name is 1-(2,3-dihydro-1-benzothiophen-6-yl)propan-2-amine.
| Compound Name | 1-(2,3-dihydro-1-benzothiophen-6-yl)propan-2-amine |
|---|---|
| PubChem CID | 117284206 |
| Molecular Formula | C11H15NS |
| Molecular Weight | 193.31 g/mol |
| Exact Mass | 193.09 |
| IUPAC Name | 1-(2,3-dihydro-1-benzothiophen-6-yl)propan-2-amine |
| SMILES | CC(N)Cc1ccc2c(c1)SCC2 |
| InChI | InChI=1S/C11H15NS/c1-8(12)6-9-2-3-10-4-5-13-11(10)7-9/h2-3,7-8H,4-6,12H2,1H3 |
| InChIKey | FZYLZFMFASDBAX-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.31 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |