C14H19Cl2NS — CID 168763926
4,4-dichloro-3-(2,3-dihydro-1-benzothiophen-6-yl)-N-ethylbutan-2-amine (PubChem CID 168763926) has the molecular formula C14H19Cl2NS and a molecular weight of 304.29 g/mol. Its IUPAC name is 4,4-dichloro-3-(2,3-dihydro-1-benzothiophen-6-yl)-N-ethylbutan-2-amine.
| Compound Name | 4,4-dichloro-3-(2,3-dihydro-1-benzothiophen-6-yl)-N-ethylbutan-2-amine |
|---|---|
| PubChem CID | 168763926 |
| Molecular Formula | C14H19Cl2NS |
| Molecular Weight | 304.29 g/mol |
| Exact Mass | 303.06 |
| IUPAC Name | 4,4-dichloro-3-(2,3-dihydro-1-benzothiophen-6-yl)-N-ethylbutan-2-amine |
| SMILES | CCNC(C)C(c1ccc2c(c1)SCC2)C(Cl)Cl |
| InChI | InChI=1S/C14H19Cl2NS/c1-3-17-9(2)13(14(15)16)11-5-4-10-6-7-18-12(10)8-11/h4-5,8-9,13-14,17H,3,6-7H2,1-2H3 |
| InChIKey | XJLAUICKBQBZTA-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.29 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|