C14H18Cl3NOS — CID 168764185
4,4,4-trichloro-1-(2,3-dihydro-1-benzothiophen-6-yl)-2-(ethylamino)butan-1-ol (PubChem CID 168764185) has the molecular formula C14H18Cl3NOS and a molecular weight of 354.73 g/mol. Its IUPAC name is 4,4,4-trichloro-1-(2,3-dihydro-1-benzothiophen-6-yl)-2-(ethylamino)butan-1-ol.
| Compound Name | 4,4,4-trichloro-1-(2,3-dihydro-1-benzothiophen-6-yl)-2-(ethylamino)butan-1-ol |
|---|---|
| PubChem CID | 168764185 |
| Molecular Formula | C14H18Cl3NOS |
| Molecular Weight | 354.73 g/mol |
| Exact Mass | 353.02 |
| IUPAC Name | 4,4,4-trichloro-1-(2,3-dihydro-1-benzothiophen-6-yl)-2-(ethylamino)butan-1-ol |
| SMILES | CCNC(CC(Cl)(Cl)Cl)C(O)c1ccc2c(c1)SCC2 |
| InChI | InChI=1S/C14H18Cl3NOS/c1-2-18-11(8-14(15,16)17)13(19)10-4-3-9-5-6-20-12(9)7-10/h3-4,7,11,13,18-19H,2,5-6,8H2,1H3 |
| InChIKey | XKWOHRJKSPYYMT-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.73 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|