C24H38N4 — CID 11728681
N-[(E)-[(3E,17E,19E)-19-(dimethylhydrazinylidene)icosa-3,17-dien-9,11-diyn-2-ylidene]amino]-N-methylmethanamine (PubChem CID 11728681) has the molecular formula C24H38N4 and a molecular weight of 382.60 g/mol. Its IUPAC name is N-[(E)-[(3E,17E,19E)-19-(dimethylhydrazinylidene)icosa-3,17-dien-9,11-diyn-2-ylidene]amino]-N-methylmethanamine.
| Compound Name | N-[(E)-[(3E,17E,19E)-19-(dimethylhydrazinylidene)icosa-3,17-dien-9,11-diyn-2-ylidene]amino]-N-methylmethanamine |
|---|---|
| PubChem CID | 11728681 |
| Molecular Formula | C24H38N4 |
| Molecular Weight | 382.60 g/mol |
| Exact Mass | 382.31 |
| IUPAC Name | N-[(E)-[(3E,17E,19E)-19-(dimethylhydrazinylidene)icosa-3,17-dien-9,11-diyn-2-ylidene]amino]-N-methylmethanamine |
| SMILES | CC(/C=C/CCCCC#CC#CCCCC/C=C/C(C)=N/N(C)C)=N\N(C)C |
| InChI | InChI=1S/C24H38N4/c1-23(25-27(3)4)21-19-17-15-13-11-9-7-8-10-12-14-16-18-20-22-24(2)26-28(5)6/h19-22H,11-18H2,1-6H3/b21-19+,22-20+,25-23+,26-24+ |
| InChIKey | BQRJBDGPALUNDI-QNZGTZDUSA-N |
| XLogP | 5.10 |
| TPSA | 31.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.60 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|