C22H34N4 — CID 11035629
N-[(E)-[(2E,16E,18E)-18-(dimethylhydrazinylidene)octadeca-2,16-dien-8,10-diynylidene]amino]-N-methylmethanamine (PubChem CID 11035629) has the molecular formula C22H34N4 and a molecular weight of 354.54 g/mol. Its IUPAC name is N-[(E)-[(2E,16E,18E)-18-(dimethylhydrazinylidene)octadeca-2,16-dien-8,10-diynylidene]amino]-N-methylmethanamine.
| Compound Name | N-[(E)-[(2E,16E,18E)-18-(dimethylhydrazinylidene)octadeca-2,16-dien-8,10-diynylidene]amino]-N-methylmethanamine |
|---|---|
| PubChem CID | 11035629 |
| Molecular Formula | C22H34N4 |
| Molecular Weight | 354.54 g/mol |
| Exact Mass | 354.28 |
| IUPAC Name | N-[(E)-[(2E,16E,18E)-18-(dimethylhydrazinylidene)octadeca-2,16-dien-8,10-diynylidene]amino]-N-methylmethanamine |
| SMILES | CN(C)/N=C/C=C/CCCCC#CC#CCCCC/C=C/C=N/N(C)C |
| InChI | InChI=1S/C22H34N4/c1-25(2)23-21-19-17-15-13-11-9-7-5-6-8-10-12-14-16-18-20-22-24-26(3)4/h17-22H,9-16H2,1-4H3/b19-17+,20-18+,23-21+,24-22+ |
| InChIKey | GXSCMAXONLTZPB-RAHHSKRVSA-N |
| XLogP | 4.32 |
| TPSA | 31.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.54 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|