C11H18N2 — CID 135080051
N-[(E)-[(Z)-3-ethynylhept-2-enylidene]amino]-N-methylmethanamine (PubChem CID 135080051) has the molecular formula C11H18N2 and a molecular weight of 178.28 g/mol. Its IUPAC name is N-[(E)-[(Z)-3-ethynylhept-2-enylidene]amino]-N-methylmethanamine.
| Compound Name | N-[(E)-[(Z)-3-ethynylhept-2-enylidene]amino]-N-methylmethanamine |
|---|---|
| PubChem CID | 135080051 |
| Molecular Formula | C11H18N2 |
| Molecular Weight | 178.28 g/mol |
| Exact Mass | 178.15 |
| IUPAC Name | N-[(E)-[(Z)-3-ethynylhept-2-enylidene]amino]-N-methylmethanamine |
| SMILES | C#C/C(=C\C=N\N(C)C)CCCC |
| InChI | InChI=1S/C11H18N2/c1-5-7-8-11(6-2)9-10-12-13(3)4/h2,9-10H,5,7-8H2,1,3-4H3/b11-9+,12-10+ |
| InChIKey | SKRDIWADHRFVLO-WGDLNXRISA-N |
| XLogP | 2.28 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.28 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|