C20H38N2 — CID 177489737
N-methyl-N-[(E)-[(6Z,11E)-octadeca-6,11-dienylidene]amino]methanamine (PubChem CID 177489737) has the molecular formula C20H38N2 and a molecular weight of 306.54 g/mol. Its IUPAC name is N-methyl-N-[(E)-[(6Z,11E)-octadeca-6,11-dienylidene]amino]methanamine.
| Compound Name | N-methyl-N-[(E)-[(6Z,11E)-octadeca-6,11-dienylidene]amino]methanamine |
|---|---|
| PubChem CID | 177489737 |
| Molecular Formula | C20H38N2 |
| Molecular Weight | 306.54 g/mol |
| Exact Mass | 306.30 |
| IUPAC Name | N-methyl-N-[(E)-[(6Z,11E)-octadeca-6,11-dienylidene]amino]methanamine |
| SMILES | CCCCCC/C=C/CCC/C=C\CCCC/C=N/N(C)C |
| InChI | InChI=1S/C20H38N2/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22(2)3/h9-10,14-15,20H,4-8,11-13,16-19H2,1-3H3/b10-9+,15-14-,21-20+ |
| InChIKey | AISGYALRPRGZHR-MCJQPXFESA-N |
| XLogP | 6.35 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.54 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|