C11H15ClO — CID 117288127
3-(3-chloro-2,5-dimethylphenyl)propan-1-ol (PubChem CID 117288127) has the molecular formula C11H15ClO and a molecular weight of 198.69 g/mol. Its IUPAC name is 3-(3-chloro-2,5-dimethylphenyl)propan-1-ol.
| Compound Name | 3-(3-chloro-2,5-dimethylphenyl)propan-1-ol |
|---|---|
| PubChem CID | 117288127 |
| Molecular Formula | C11H15ClO |
| Molecular Weight | 198.69 g/mol |
| Exact Mass | 198.08 |
| IUPAC Name | 3-(3-chloro-2,5-dimethylphenyl)propan-1-ol |
| SMILES | Cc1cc(Cl)c(C)c(CCCO)c1 |
| InChI | InChI=1S/C11H15ClO/c1-8-6-10(4-3-5-13)9(2)11(12)7-8/h6-7,13H,3-5H2,1-2H3 |
| InChIKey | IYCFYJSXSRQZLR-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.69 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |