2-(3-chloro-2,5-dimethylphenyl)acetyl chloride

C10H10Cl2O — CID 163303747

IUPAC2-(3-chloro-2,5-dimethylphenyl)acetyl chloride
SMILESCc1cc(Cl)c(C)c(CC(=O)Cl)c1
InChIInChI=1S/C10H10Cl2O/c1-6-3-8(5-10(12)13)7(2)9(11)4-6/h3-4H,5H2,1-2H3
InChIKeyDPQMBEBFLFJJCR-UHFFFAOYSA-N
MW217.09 g/mol
LogP3.26
Rot. Bonds2

About 2-(3-chloro-2,5-dimethylphenyl)acetyl chloride

2-(3-chloro-2,5-dimethylphenyl)acetyl chloride (PubChem CID 163303747) has the molecular formula C10H10Cl2O and a molecular weight of 217.09 g/mol. Its IUPAC name is 2-(3-chloro-2,5-dimethylphenyl)acetyl chloride.

Molecular Properties

Compound Name2-(3-chloro-2,5-dimethylphenyl)acetyl chloride
PubChem CID163303747
Molecular FormulaC10H10Cl2O
Molecular Weight217.09 g/mol
Exact Mass216.01
IUPAC Name2-(3-chloro-2,5-dimethylphenyl)acetyl chloride
SMILESCc1cc(Cl)c(C)c(CC(=O)Cl)c1
InChIInChI=1S/C10H10Cl2O/c1-6-3-8(5-10(12)13)7(2)9(11)4-6/h3-4H,5H2,1-2H3
InChIKeyDPQMBEBFLFJJCR-UHFFFAOYSA-N
XLogP3.26
TPSA17.07 Ų
H-Bond Donors
H-Bond Acceptors1
Rotatable Bonds2
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500217.09
LogP ≤ 53.26
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acid_halide', 'substructure': 'N/A'}

Analyze 2-(3-chloro-2,5-dimethylphenyl)acetyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(3-chloro-2,5-dimethylphenyl)acetyl chloride?
The IUPAC name of 2-(3-chloro-2,5-dimethylphenyl)acetyl chloride (CID 163303747) is 2-(3-chloro-2,5-dimethylphenyl)acetyl chloride.
What is the SMILES notation for 2-(3-chloro-2,5-dimethylphenyl)acetyl chloride?
The canonical SMILES for 2-(3-chloro-2,5-dimethylphenyl)acetyl chloride is Cc1cc(Cl)c(C)c(CC(=O)Cl)c1.
What is the InChIKey of 2-(3-chloro-2,5-dimethylphenyl)acetyl chloride?
The InChIKey is DPQMBEBFLFJJCR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10Cl2O/c1-6-3-8(5-10(12)13)7(2)9(11)4-6/h3-4H,5H2,1-2H3.
What are the key properties of 2-(3-chloro-2,5-dimethylphenyl)acetyl chloride?
2-(3-chloro-2,5-dimethylphenyl)acetyl chloride has a molecular weight of 217.09 g/mol, XLogP of 3.26, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-chloro-2,5-dimethylphenyl)acetyl chloride is sourced from PubChem (CID 163303747), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).