C10H10Cl2O — CID 163303747
2-(3-chloro-2,5-dimethylphenyl)acetyl chloride (PubChem CID 163303747) has the molecular formula C10H10Cl2O and a molecular weight of 217.09 g/mol. Its IUPAC name is 2-(3-chloro-2,5-dimethylphenyl)acetyl chloride.
| Compound Name | 2-(3-chloro-2,5-dimethylphenyl)acetyl chloride |
|---|---|
| PubChem CID | 163303747 |
| Molecular Formula | C10H10Cl2O |
| Molecular Weight | 217.09 g/mol |
| Exact Mass | 216.01 |
| IUPAC Name | 2-(3-chloro-2,5-dimethylphenyl)acetyl chloride |
| SMILES | Cc1cc(Cl)c(C)c(CC(=O)Cl)c1 |
| InChI | InChI=1S/C10H10Cl2O/c1-6-3-8(5-10(12)13)7(2)9(11)4-6/h3-4H,5H2,1-2H3 |
| InChIKey | DPQMBEBFLFJJCR-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.09 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|