About [(E)-7-(1,3-benzodioxol-5-yl)-1-oxo-1-piperidin-1-ylhept-4-en-3-yl] methyl carbonate
[(E)-7-(1,3-benzodioxol-5-yl)-1-oxo-1-piperidin-1-ylhept-4-en-3-yl] methyl carbonate (PubChem CID 11728843) has the molecular formula C21H27NO6
and a molecular weight of 389.45 g/mol. Its IUPAC name is [(E)-7-(1,3-benzodioxol-5-yl)-1-oxo-1-piperidin-1-ylhept-4-en-3-yl] methyl carbonate.
Molecular Properties
| Compound Name | [(E)-7-(1,3-benzodioxol-5-yl)-1-oxo-1-piperidin-1-ylhept-4-en-3-yl] methyl carbonate |
| PubChem CID | 11728843 |
| Molecular Formula | C21H27NO6 |
| Molecular Weight | 389.45 g/mol |
| Exact Mass | 389.18 |
| IUPAC Name | [(E)-7-(1,3-benzodioxol-5-yl)-1-oxo-1-piperidin-1-ylhept-4-en-3-yl] methyl carbonate |
| SMILES | COC(=O)OC(/C=C/CCc1ccc2c(c1)OCO2)CC(=O)N1CCCCC1 |
| InChI | InChI=1S/C21H27NO6/c1-25-21(24)28-17(14-20(23)22-11-5-2-6-12-22)8-4-3-7-16-9-10-18-19(13-16)27-15-26-18/h4,8-10,13,17H,2-3,5-7,11-12,14-15H2,1H3/b8-4+ |
| InChIKey | PIPUQMSPTPIKEU-XBXARRHUSA-N |
| XLogP | 3.46 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 389.45 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [(E)-7-(1,3-benzodioxol-5-yl)-1-oxo-1-piperidin-1-ylhept-4-en-3-yl] methyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(E)-7-(1,3-benzodioxol-5-yl)-1-oxo-1-piperidin-1-ylhept-4-en-3-yl] methyl carbonate?
The IUPAC name of [(E)-7-(1,3-benzodioxol-5-yl)-1-oxo-1-piperidin-1-ylhept-4-en-3-yl] methyl carbonate (CID 11728843) is [(E)-7-(1,3-benzodioxol-5-yl)-1-oxo-1-piperidin-1-ylhept-4-en-3-yl] methyl carbonate.
What is the SMILES notation for [(E)-7-(1,3-benzodioxol-5-yl)-1-oxo-1-piperidin-1-ylhept-4-en-3-yl] methyl carbonate?
The canonical SMILES for [(E)-7-(1,3-benzodioxol-5-yl)-1-oxo-1-piperidin-1-ylhept-4-en-3-yl] methyl carbonate is COC(=O)OC(/C=C/CCc1ccc2c(c1)OCO2)CC(=O)N1CCCCC1.
What is the InChIKey of [(E)-7-(1,3-benzodioxol-5-yl)-1-oxo-1-piperidin-1-ylhept-4-en-3-yl] methyl carbonate?
The InChIKey is PIPUQMSPTPIKEU-XBXARRHUSA-N. The full InChI is InChI=1S/C21H27NO6/c1-25-21(24)28-17(14-20(23)22-11-5-2-6-12-22)8-4-3-7-16-9-10-18-19(13-16)27-15-26-18/h4,8-10,13,17H,2-3,5-7,11-12,14-15H2,1H3/b8-4+.
What are the key properties of [(E)-7-(1,3-benzodioxol-5-yl)-1-oxo-1-piperidin-1-ylhept-4-en-3-yl] methyl carbonate?
[(E)-7-(1,3-benzodioxol-5-yl)-1-oxo-1-piperidin-1-ylhept-4-en-3-yl] methyl carbonate has a molecular weight of 389.45 g/mol, XLogP of 3.46, 7 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [(E)-7-(1,3-benzodioxol-5-yl)-1-oxo-1-piperidin-1-ylhept-4-en-3-yl] methyl carbonate is sourced from PubChem (CID 11728843), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).