C11H8N2O2 — CID 117289145
6-(1-isocyanatocyclopropyl)-1,2-benzoxazole (PubChem CID 117289145) has the molecular formula C11H8N2O2 and a molecular weight of 200.20 g/mol. Its IUPAC name is 6-(1-isocyanatocyclopropyl)-1,2-benzoxazole.
| Compound Name | 6-(1-isocyanatocyclopropyl)-1,2-benzoxazole |
|---|---|
| PubChem CID | 117289145 |
| Molecular Formula | C11H8N2O2 |
| Molecular Weight | 200.20 g/mol |
| Exact Mass | 200.06 |
| IUPAC Name | 6-(1-isocyanatocyclopropyl)-1,2-benzoxazole |
| SMILES | O=C=NC1(c2ccc3cnoc3c2)CC1 |
| InChI | InChI=1S/C11H8N2O2/c14-7-12-11(3-4-11)9-2-1-8-6-13-15-10(8)5-9/h1-2,5-6H,3-4H2 |
| InChIKey | FPTDPGFFXFTBDF-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 55.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.20 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|