About 3-phthalazin-5-ylbutanal
3-phthalazin-5-ylbutanal (PubChem CID 117289425) has the molecular formula C12H12N2O
and a molecular weight of 200.24 g/mol. Its IUPAC name is 3-phthalazin-5-ylbutanal.
Molecular Properties
| Compound Name | 3-phthalazin-5-ylbutanal |
| PubChem CID | 117289425 |
| Molecular Formula | C12H12N2O |
| Molecular Weight | 200.24 g/mol |
| Exact Mass | 200.09 |
| IUPAC Name | 3-phthalazin-5-ylbutanal |
| SMILES | CC(CC=O)c1cccc2cnncc12 |
| InChI | InChI=1S/C12H12N2O/c1-9(5-6-15)11-4-2-3-10-7-13-14-8-12(10)11/h2-4,6-9H,5H2,1H3 |
| InChIKey | LUMRMGUNVCUYRV-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 42.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.24 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 3-phthalazin-5-ylbutanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-phthalazin-5-ylbutanal?
The IUPAC name of 3-phthalazin-5-ylbutanal (CID 117289425) is 3-phthalazin-5-ylbutanal.
What is the SMILES notation for 3-phthalazin-5-ylbutanal?
The canonical SMILES for 3-phthalazin-5-ylbutanal is CC(CC=O)c1cccc2cnncc12.
What is the InChIKey of 3-phthalazin-5-ylbutanal?
The InChIKey is LUMRMGUNVCUYRV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12N2O/c1-9(5-6-15)11-4-2-3-10-7-13-14-8-12(10)11/h2-4,6-9H,5H2,1H3.
What are the key properties of 3-phthalazin-5-ylbutanal?
3-phthalazin-5-ylbutanal has a molecular weight of 200.24 g/mol, XLogP of 2.32, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-phthalazin-5-ylbutanal is sourced from PubChem (CID 117289425), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).