C13H15FO — CID 117294882
3-(3-fluoro-5,6,7,8-tetrahydronaphthalen-2-yl)propanal (PubChem CID 117294882) has the molecular formula C13H15FO and a molecular weight of 206.26 g/mol. Its IUPAC name is 3-(3-fluoro-5,6,7,8-tetrahydronaphthalen-2-yl)propanal.
| Compound Name | 3-(3-fluoro-5,6,7,8-tetrahydronaphthalen-2-yl)propanal |
|---|---|
| PubChem CID | 117294882 |
| Molecular Formula | C13H15FO |
| Molecular Weight | 206.26 g/mol |
| Exact Mass | 206.11 |
| IUPAC Name | 3-(3-fluoro-5,6,7,8-tetrahydronaphthalen-2-yl)propanal |
| SMILES | O=CCCc1cc2c(cc1F)CCCC2 |
| InChI | InChI=1S/C13H15FO/c14-13-9-11-5-2-1-4-10(11)8-12(13)6-3-7-15/h7-9H,1-6H2 |
| InChIKey | GELMOJKQTLTYCW-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.26 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|