C20H23FN2O — CID 89062923
3-[2-fluoro-4-[(1-methyl-3,4-dihydro-2H-quinolin-7-yl)methylamino]phenyl]propanal (PubChem CID 89062923) has the molecular formula C20H23FN2O and a molecular weight of 326.42 g/mol. Its IUPAC name is 3-[2-fluoro-4-[(1-methyl-3,4-dihydro-2H-quinolin-7-yl)methylamino]phenyl]propanal.
| Compound Name | 3-[2-fluoro-4-[(1-methyl-3,4-dihydro-2H-quinolin-7-yl)methylamino]phenyl]propanal |
|---|---|
| PubChem CID | 89062923 |
| Molecular Formula | C20H23FN2O |
| Molecular Weight | 326.42 g/mol |
| Exact Mass | 326.18 |
| IUPAC Name | 3-[2-fluoro-4-[(1-methyl-3,4-dihydro-2H-quinolin-7-yl)methylamino]phenyl]propanal |
| SMILES | CN1CCCc2ccc(CNc3ccc(CCC=O)c(F)c3)cc21 |
| InChI | InChI=1S/C20H23FN2O/c1-23-10-2-4-17-7-6-15(12-20(17)23)14-22-18-9-8-16(5-3-11-24)19(21)13-18/h6-9,11-13,22H,2-5,10,14H2,1H3 |
| InChIKey | XWZUKNYMMHPKNB-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.42 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|