C25H27N3O — CID 89062883
3-[2-methyl-6-[(1-phenyl-3,4-dihydro-2H-quinolin-7-yl)methylamino]-3-pyridinyl]propanal (PubChem CID 89062883) has the molecular formula C25H27N3O and a molecular weight of 385.51 g/mol. Its IUPAC name is 3-[2-methyl-6-[(1-phenyl-3,4-dihydro-2H-quinolin-7-yl)methylamino]-3-pyridinyl]propanal.
| Compound Name | 3-[2-methyl-6-[(1-phenyl-3,4-dihydro-2H-quinolin-7-yl)methylamino]-3-pyridinyl]propanal |
|---|---|
| PubChem CID | 89062883 |
| Molecular Formula | C25H27N3O |
| Molecular Weight | 385.51 g/mol |
| Exact Mass | 385.22 |
| IUPAC Name | 3-[2-methyl-6-[(1-phenyl-3,4-dihydro-2H-quinolin-7-yl)methylamino]-3-pyridinyl]propanal |
| SMILES | Cc1nc(NCc2ccc3c(c2)N(c2ccccc2)CCC3)ccc1CCC=O |
| InChI | InChI=1S/C25H27N3O/c1-19-21(8-6-16-29)13-14-25(27-19)26-18-20-11-12-22-7-5-15-28(24(22)17-20)23-9-3-2-4-10-23/h2-4,9-14,16-17H,5-8,15,18H2,1H3,(H,26,27) |
| InChIKey | PGXHPHJWFBHYLX-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.51 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|