C26H26ClFN2O — CID 89063059
3-[4-[[1-(4-chlorophenyl)-8-methyl-3,4-dihydro-2H-quinolin-7-yl]methylamino]-2-fluorophenyl]propanal (PubChem CID 89063059) has the molecular formula C26H26ClFN2O and a molecular weight of 436.96 g/mol. Its IUPAC name is 3-[4-[[1-(4-chlorophenyl)-8-methyl-3,4-dihydro-2H-quinolin-7-yl]methylamino]-2-fluorophenyl]propanal.
| Compound Name | 3-[4-[[1-(4-chlorophenyl)-8-methyl-3,4-dihydro-2H-quinolin-7-yl]methylamino]-2-fluorophenyl]propanal |
|---|---|
| PubChem CID | 89063059 |
| Molecular Formula | C26H26ClFN2O |
| Molecular Weight | 436.96 g/mol |
| Exact Mass | 436.17 |
| IUPAC Name | 3-[4-[[1-(4-chlorophenyl)-8-methyl-3,4-dihydro-2H-quinolin-7-yl]methylamino]-2-fluorophenyl]propanal |
| SMILES | Cc1c(CNc2ccc(CCC=O)c(F)c2)ccc2c1N(c1ccc(Cl)cc1)CCC2 |
| InChI | InChI=1S/C26H26ClFN2O/c1-18-21(17-29-23-11-8-19(5-3-15-31)25(28)16-23)7-6-20-4-2-14-30(26(18)20)24-12-9-22(27)10-13-24/h6-13,15-16,29H,2-5,14,17H2,1H3 |
| InChIKey | IIFVZMIRZZELLJ-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.96 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|