diethyl 2,6-bis(bromomethyl)-4-oxopyran-3,5-dicarboxylate

C13H14Br2O6 — CID 11729596

IUPACdiethyl 2,6-bis(bromomethyl)-4-oxopyran-3,5-dicarboxylate
SMILESCCOC(=O)c1c(CBr)oc(CBr)c(C(=O)OCC)c1=O
InChIInChI=1S/C13H14Br2O6/c1-3-19-12(17)9-7(5-14)21-8(6-15)10(11(9)16)13(18)20-4-2/h3-6H2,1-2H3
InChIKeyFFGOSFBGIRPWBX-UHFFFAOYSA-N
MW426.06 g/mol
LogP2.78
Rot. Bonds6

About diethyl 2,6-bis(bromomethyl)-4-oxopyran-3,5-dicarboxylate

diethyl 2,6-bis(bromomethyl)-4-oxopyran-3,5-dicarboxylate (PubChem CID 11729596) has the molecular formula C13H14Br2O6 and a molecular weight of 426.06 g/mol. Its IUPAC name is diethyl 2,6-bis(bromomethyl)-4-oxopyran-3,5-dicarboxylate.

Molecular Properties

Compound Namediethyl 2,6-bis(bromomethyl)-4-oxopyran-3,5-dicarboxylate
PubChem CID11729596
Molecular FormulaC13H14Br2O6
Molecular Weight426.06 g/mol
Exact Mass423.92
IUPAC Namediethyl 2,6-bis(bromomethyl)-4-oxopyran-3,5-dicarboxylate
SMILESCCOC(=O)c1c(CBr)oc(CBr)c(C(=O)OCC)c1=O
InChIInChI=1S/C13H14Br2O6/c1-3-19-12(17)9-7(5-14)21-8(6-15)10(11(9)16)13(18)20-4-2/h3-6H2,1-2H3
InChIKeyFFGOSFBGIRPWBX-UHFFFAOYSA-N
XLogP2.78
TPSA82.81 Ų
H-Bond Donors
H-Bond Acceptors6
Rotatable Bonds6
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500426.06
LogP ≤ 52.78
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 106

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'alkyl_halide', 'substructure': 'N/A'}

Analyze diethyl 2,6-bis(bromomethyl)-4-oxopyran-3,5-dicarboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of diethyl 2,6-bis(bromomethyl)-4-oxopyran-3,5-dicarboxylate?
The IUPAC name of diethyl 2,6-bis(bromomethyl)-4-oxopyran-3,5-dicarboxylate (CID 11729596) is diethyl 2,6-bis(bromomethyl)-4-oxopyran-3,5-dicarboxylate.
What is the SMILES notation for diethyl 2,6-bis(bromomethyl)-4-oxopyran-3,5-dicarboxylate?
The canonical SMILES for diethyl 2,6-bis(bromomethyl)-4-oxopyran-3,5-dicarboxylate is CCOC(=O)c1c(CBr)oc(CBr)c(C(=O)OCC)c1=O.
What is the InChIKey of diethyl 2,6-bis(bromomethyl)-4-oxopyran-3,5-dicarboxylate?
The InChIKey is FFGOSFBGIRPWBX-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14Br2O6/c1-3-19-12(17)9-7(5-14)21-8(6-15)10(11(9)16)13(18)20-4-2/h3-6H2,1-2H3.
What are the key properties of diethyl 2,6-bis(bromomethyl)-4-oxopyran-3,5-dicarboxylate?
diethyl 2,6-bis(bromomethyl)-4-oxopyran-3,5-dicarboxylate has a molecular weight of 426.06 g/mol, XLogP of 2.78, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for diethyl 2,6-bis(bromomethyl)-4-oxopyran-3,5-dicarboxylate is sourced from PubChem (CID 11729596), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).