C13H14Br2O6 — CID 11729596
diethyl 2,6-bis(bromomethyl)-4-oxopyran-3,5-dicarboxylate (PubChem CID 11729596) has the molecular formula C13H14Br2O6 and a molecular weight of 426.06 g/mol. Its IUPAC name is diethyl 2,6-bis(bromomethyl)-4-oxopyran-3,5-dicarboxylate.
| Compound Name | diethyl 2,6-bis(bromomethyl)-4-oxopyran-3,5-dicarboxylate |
|---|---|
| PubChem CID | 11729596 |
| Molecular Formula | C13H14Br2O6 |
| Molecular Weight | 426.06 g/mol |
| Exact Mass | 423.92 |
| IUPAC Name | diethyl 2,6-bis(bromomethyl)-4-oxopyran-3,5-dicarboxylate |
| SMILES | CCOC(=O)c1c(CBr)oc(CBr)c(C(=O)OCC)c1=O |
| InChI | InChI=1S/C13H14Br2O6/c1-3-19-12(17)9-7(5-14)21-8(6-15)10(11(9)16)13(18)20-4-2/h3-6H2,1-2H3 |
| InChIKey | FFGOSFBGIRPWBX-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 82.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.06 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|