C11H10Br2O6 — CID 15420871
dimethyl 2,6-bis(bromomethyl)-4-oxopyran-3,5-dicarboxylate (PubChem CID 15420871) has the molecular formula C11H10Br2O6 and a molecular weight of 398.00 g/mol. Its IUPAC name is dimethyl 2,6-bis(bromomethyl)-4-oxopyran-3,5-dicarboxylate.
| Compound Name | dimethyl 2,6-bis(bromomethyl)-4-oxopyran-3,5-dicarboxylate |
|---|---|
| PubChem CID | 15420871 |
| Molecular Formula | C11H10Br2O6 |
| Molecular Weight | 398.00 g/mol |
| Exact Mass | 395.88 |
| IUPAC Name | dimethyl 2,6-bis(bromomethyl)-4-oxopyran-3,5-dicarboxylate |
| SMILES | COC(=O)c1c(CBr)oc(CBr)c(C(=O)OC)c1=O |
| InChI | InChI=1S/C11H10Br2O6/c1-17-10(15)7-5(3-12)19-6(4-13)8(9(7)14)11(16)18-2/h3-4H2,1-2H3 |
| InChIKey | LVJAMLYKOMKKLC-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 82.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.00 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|