C11H11BrO6 — CID 15420872
dimethyl 2-(bromomethyl)-6-methyl-4-oxopyran-3,5-dicarboxylate (PubChem CID 15420872) has the molecular formula C11H11BrO6 and a molecular weight of 319.11 g/mol. Its IUPAC name is dimethyl 2-(bromomethyl)-6-methyl-4-oxopyran-3,5-dicarboxylate.
| Compound Name | dimethyl 2-(bromomethyl)-6-methyl-4-oxopyran-3,5-dicarboxylate |
|---|---|
| PubChem CID | 15420872 |
| Molecular Formula | C11H11BrO6 |
| Molecular Weight | 319.11 g/mol |
| Exact Mass | 317.97 |
| IUPAC Name | dimethyl 2-(bromomethyl)-6-methyl-4-oxopyran-3,5-dicarboxylate |
| SMILES | COC(=O)c1c(C)oc(CBr)c(C(=O)OC)c1=O |
| InChI | InChI=1S/C11H11BrO6/c1-5-7(10(14)16-2)9(13)8(11(15)17-3)6(4-12)18-5/h4H2,1-3H3 |
| InChIKey | KMVXSGOALDSPMW-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 82.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.11 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|