C12H17NO2 — CID 117296343
3-(5-methyl-1,3-benzodioxol-4-yl)butan-1-amine (PubChem CID 117296343) has the molecular formula C12H17NO2 and a molecular weight of 207.27 g/mol. Its IUPAC name is 3-(5-methyl-1,3-benzodioxol-4-yl)butan-1-amine.
| Compound Name | 3-(5-methyl-1,3-benzodioxol-4-yl)butan-1-amine |
|---|---|
| PubChem CID | 117296343 |
| Molecular Formula | C12H17NO2 |
| Molecular Weight | 207.27 g/mol |
| Exact Mass | 207.13 |
| IUPAC Name | 3-(5-methyl-1,3-benzodioxol-4-yl)butan-1-amine |
| SMILES | Cc1ccc2c(c1C(C)CCN)OCO2 |
| InChI | InChI=1S/C12H17NO2/c1-8-3-4-10-12(15-7-14-10)11(8)9(2)5-6-13/h3-4,9H,5-7,13H2,1-2H3 |
| InChIKey | BKBAACUFBKNCDN-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.27 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |