C11H15NO3 — CID 117298510
4-(2-aminoethyl)-2,3-dimethoxybenzaldehyde (PubChem CID 117298510) has the molecular formula C11H15NO3 and a molecular weight of 209.25 g/mol. Its IUPAC name is 4-(2-aminoethyl)-2,3-dimethoxybenzaldehyde.
| Compound Name | 4-(2-aminoethyl)-2,3-dimethoxybenzaldehyde |
|---|---|
| PubChem CID | 117298510 |
| Molecular Formula | C11H15NO3 |
| Molecular Weight | 209.25 g/mol |
| Exact Mass | 209.11 |
| IUPAC Name | 4-(2-aminoethyl)-2,3-dimethoxybenzaldehyde |
| SMILES | COc1c(C=O)ccc(CCN)c1OC |
| InChI | InChI=1S/C11H15NO3/c1-14-10-8(5-6-12)3-4-9(7-13)11(10)15-2/h3-4,7H,5-6,12H2,1-2H3 |
| InChIKey | KXNCYLMUJAHKGM-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.25 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|