C12H18N2O — CID 84674503
2-(4-methoxy-1-methyl-2,3-dihydroindol-5-yl)ethanamine (PubChem CID 84674503) has the molecular formula C12H18N2O and a molecular weight of 206.29 g/mol. Its IUPAC name is 2-(4-methoxy-1-methyl-2,3-dihydroindol-5-yl)ethanamine.
| Compound Name | 2-(4-methoxy-1-methyl-2,3-dihydroindol-5-yl)ethanamine |
|---|---|
| PubChem CID | 84674503 |
| Molecular Formula | C12H18N2O |
| Molecular Weight | 206.29 g/mol |
| Exact Mass | 206.14 |
| IUPAC Name | 2-(4-methoxy-1-methyl-2,3-dihydroindol-5-yl)ethanamine |
| SMILES | COc1c(CCN)ccc2c1CCN2C |
| InChI | InChI=1S/C12H18N2O/c1-14-8-6-10-11(14)4-3-9(5-7-13)12(10)15-2/h3-4H,5-8,13H2,1-2H3 |
| InChIKey | GHVFGAXUAYOFCG-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.29 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |