C10H10ClNO2 — CID 117302239
4-chloro-2,3-dimethoxy-6-methylbenzonitrile (PubChem CID 117302239) has the molecular formula C10H10ClNO2 and a molecular weight of 211.65 g/mol. Its IUPAC name is 4-chloro-2,3-dimethoxy-6-methylbenzonitrile.
| Compound Name | 4-chloro-2,3-dimethoxy-6-methylbenzonitrile |
|---|---|
| PubChem CID | 117302239 |
| Molecular Formula | C10H10ClNO2 |
| Molecular Weight | 211.65 g/mol |
| Exact Mass | 211.04 |
| IUPAC Name | 4-chloro-2,3-dimethoxy-6-methylbenzonitrile |
| SMILES | COc1c(Cl)cc(C)c(C#N)c1OC |
| InChI | InChI=1S/C10H10ClNO2/c1-6-4-8(11)10(14-3)9(13-2)7(6)5-12/h4H,1-3H3 |
| InChIKey | PIINGJYVNOGTGR-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.65 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |